C8H11N3O6S — CID 112672409
4-[(2-amino-2-oxoethoxy)sulfamoyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 112672409) has the molecular formula C8H11N3O6S and a molecular weight of 277.26 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethoxy)sulfamoyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(2-amino-2-oxoethoxy)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 112672409 |
| Molecular Formula | C8H11N3O6S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-[(2-amino-2-oxoethoxy)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(S(=O)(=O)NOCC(N)=O)cc1C(=O)O |
| InChI | InChI=1S/C8H11N3O6S/c1-11-3-5(2-6(11)8(13)14)18(15,16)10-17-4-7(9)12/h2-3,10H,4H2,1H3,(H2,9,12)(H,13,14) |
| InChIKey | ZORISKBRNDMMMO-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 140.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|