C10H16N2O5S — CID 43498989
4-(1-hydroxybutan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid (PubChem CID 43498989) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-(1-hydroxybutan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-(1-hydroxybutan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43498989 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(1-hydroxybutan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid |
| SMILES | CCC(CO)NS(=O)(=O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C10H16N2O5S/c1-3-7(6-13)11-18(16,17)8-4-9(10(14)15)12(2)5-8/h4-5,7,11,13H,3,6H2,1-2H3,(H,14,15) |
| InChIKey | OYTKEDUWTQEMMM-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |