C13H22N2O4S — CID 43421839
4-(heptan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid (PubChem CID 43421839) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-(heptan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-(heptan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43421839 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(heptan-2-ylsulfamoyl)-1-methylpyrrole-2-carboxylic acid |
| SMILES | CCCCCC(C)NS(=O)(=O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C13H22N2O4S/c1-4-5-6-7-10(2)14-20(18,19)11-8-12(13(16)17)15(3)9-11/h8-10,14H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | PERARJWZWJKSBC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|