C14H23ClN2O3S — CID 65366930
1-methyl-5-(octan-2-ylcarbamoyl)pyrrole-3-sulfonyl chloride (PubChem CID 65366930) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 1-methyl-5-(octan-2-ylcarbamoyl)pyrrole-3-sulfonyl chloride.
| Compound Name | 1-methyl-5-(octan-2-ylcarbamoyl)pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65366930 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-methyl-5-(octan-2-ylcarbamoyl)pyrrole-3-sulfonyl chloride |
| SMILES | CCCCCCC(C)NC(=O)c1cc(S(=O)(=O)Cl)cn1C |
| InChI | InChI=1S/C14H23ClN2O3S/c1-4-5-6-7-8-11(2)16-14(18)13-9-12(10-17(13)3)21(15,19)20/h9-11H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | PTOHDZQJPIIBJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|