C10H17N3O4S — CID 60718274
N-(1-methoxypropan-2-yl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 60718274) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(1-methoxypropan-2-yl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60718274 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | COCC(C)NC(=O)c1cc(S(N)(=O)=O)cn1C |
| InChI | InChI=1S/C10H17N3O4S/c1-7(6-17-3)12-10(14)9-4-8(5-13(9)2)18(11,15)16/h4-5,7H,6H2,1-3H3,(H,12,14)(H2,11,15,16) |
| InChIKey | SPEYHFSBDCPKSI-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |