C10H14N4O6S — CID 63713897
(2S)-4-amino-2-[(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 63713897) has the molecular formula C10H14N4O6S and a molecular weight of 318.31 g/mol. Its IUPAC name is (2S)-4-amino-2-[(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63713897 |
| Molecular Formula | C10H14N4O6S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2S)-4-amino-2-[(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | Cn1cc(S(N)(=O)=O)cc1C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H14N4O6S/c1-14-4-5(21(12,19)20)2-7(14)9(16)13-6(10(17)18)3-8(11)15/h2,4,6H,3H2,1H3,(H2,11,15)(H,13,16)(H,17,18)(H2,12,19,20)/t6-/m0/s1 |
| InChIKey | LOJKOQQTOBELKU-LURJTMIESA-N |
| XLogP | -2.27 |
| TPSA | 174.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |