C12H16ClN3O4 — CID 63715407
(2S)-4-amino-2-[(4-chloro-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 63715407) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is (2S)-4-amino-2-[(4-chloro-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(4-chloro-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63715407 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (2S)-4-amino-2-[(4-chloro-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | CCCn1cc(Cl)cc1C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H16ClN3O4/c1-2-3-16-6-7(13)4-9(16)11(18)15-8(12(19)20)5-10(14)17/h4,6,8H,2-3,5H2,1H3,(H2,14,17)(H,15,18)(H,19,20)/t8-/m0/s1 |
| InChIKey | IMJVOSASCFBHFE-QMMMGPOBSA-N |
| XLogP | 0.61 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |