C11H14ClN3O4 — CID 43639423
4-amino-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 43639423) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 4-amino-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43639423 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-amino-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | CCn1cc(Cl)cc1C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H14ClN3O4/c1-2-15-5-6(12)3-8(15)10(17)14-7(11(18)19)4-9(13)16/h3,5,7H,2,4H2,1H3,(H2,13,16)(H,14,17)(H,18,19) |
| InChIKey | NWEVLCFONCWMMG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |