C11H15ClN2O3 — CID 43639447
3-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]butanoic acid (PubChem CID 43639447) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]butanoic acid.
| Compound Name | 3-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43639447 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]butanoic acid |
| SMILES | CCn1cc(Cl)cc1C(=O)NC(C)CC(=O)O |
| InChI | InChI=1S/C11H15ClN2O3/c1-3-14-6-8(12)5-9(14)11(17)13-7(2)4-10(15)16/h5-7H,3-4H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | OMBGZYGBYLEAIV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |