C11H18ClN3O — CID 104877038
N-[(2R)-1-aminopropan-2-yl]-4-chloro-1-propylpyrrole-2-carboxamide (PubChem CID 104877038) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is N-[(2R)-1-aminopropan-2-yl]-4-chloro-1-propylpyrrole-2-carboxamide.
| Compound Name | N-[(2R)-1-aminopropan-2-yl]-4-chloro-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104877038 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[(2R)-1-aminopropan-2-yl]-4-chloro-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)N[C@H](C)CN |
| InChI | InChI=1S/C11H18ClN3O/c1-3-4-15-7-9(12)5-10(15)11(16)14-8(2)6-13/h5,7-8H,3-4,6,13H2,1-2H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | LOKUFFFYPZXPHJ-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |