C10H16BrN3O — CID 120508288
N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-ethylpyrrole-2-carboxamide (PubChem CID 120508288) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-ethylpyrrole-2-carboxamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 120508288 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)N[C@@H](C)CN |
| InChI | InChI=1S/C10H16BrN3O/c1-3-14-6-8(11)4-9(14)10(15)13-7(2)5-12/h4,6-7H,3,5,12H2,1-2H3,(H,13,15)/t7-/m0/s1 |
| InChIKey | DNFZOBZQZBFHKZ-ZETCQYMHSA-N |
| XLogP | 1.35 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |