C8H11BrN2O — CID 43640635
4-bromo-1-ethyl-N-methylpyrrole-2-carboxamide (PubChem CID 43640635) has the molecular formula C8H11BrN2O and a molecular weight of 231.09 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43640635 |
| Molecular Formula | C8H11BrN2O |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 4-bromo-1-ethyl-N-methylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NC |
| InChI | InChI=1S/C8H11BrN2O/c1-3-11-5-6(9)4-7(11)8(12)10-2/h4-5H,3H2,1-2H3,(H,10,12) |
| InChIKey | IAXDFGBMSHIJLU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |