C12H19BrN2O — CID 43641426
4-bromo-1-ethyl-N-(3-methylbutan-2-yl)pyrrole-2-carboxamide (PubChem CID 43641426) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(3-methylbutan-2-yl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(3-methylbutan-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43641426 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-bromo-1-ethyl-N-(3-methylbutan-2-yl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NC(C)C(C)C |
| InChI | InChI=1S/C12H19BrN2O/c1-5-15-7-10(13)6-11(15)12(16)14-9(4)8(2)3/h6-9H,5H2,1-4H3,(H,14,16) |
| InChIKey | OWDYKDQSKVIIHO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |