C15H16Br2N2O — CID 63529315
4-bromo-N-[1-(3-bromophenyl)ethyl]-1-ethylpyrrole-2-carboxamide (PubChem CID 63529315) has the molecular formula C15H16Br2N2O and a molecular weight of 400.11 g/mol. Its IUPAC name is 4-bromo-N-[1-(3-bromophenyl)ethyl]-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-(3-bromophenyl)ethyl]-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63529315 |
| Molecular Formula | C15H16Br2N2O |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 4-bromo-N-[1-(3-bromophenyl)ethyl]-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NC(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16Br2N2O/c1-3-19-9-13(17)8-14(19)15(20)18-10(2)11-5-4-6-12(16)7-11/h4-10H,3H2,1-2H3,(H,18,20) |
| InChIKey | MHFHTHUEFMCNEN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |