C15H19BrClN3O — CID 119527518
N-(2-amino-2-phenylethyl)-4-bromo-1-ethylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119527518) has the molecular formula C15H19BrClN3O and a molecular weight of 372.69 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-4-bromo-1-ethylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-4-bromo-1-ethylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119527518 |
| Molecular Formula | C15H19BrClN3O |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-4-bromo-1-ethylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CCn1cc(Br)cc1C(=O)NCC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C15H18BrN3O.ClH/c1-2-19-10-12(16)8-14(19)15(20)18-9-13(17)11-6-4-3-5-7-11;/h3-8,10,13H,2,9,17H2,1H3,(H,18,20);1H |
| InChIKey | VGWKCFTUEZFISQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |