C12H19BrN2O2 — CID 66106842
4-bromo-1-ethyl-N-(4-hydroxy-2-methylbutyl)pyrrole-2-carboxamide (PubChem CID 66106842) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(4-hydroxy-2-methylbutyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(4-hydroxy-2-methylbutyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66106842 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-bromo-1-ethyl-N-(4-hydroxy-2-methylbutyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCC(C)CCO |
| InChI | InChI=1S/C12H19BrN2O2/c1-3-15-8-10(13)6-11(15)12(17)14-7-9(2)4-5-16/h6,8-9,16H,3-5,7H2,1-2H3,(H,14,17) |
| InChIKey | KOBCQQLPEXUCTN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |