C11H17BrN2O3 — CID 66175814
4-bromo-N-(2,3-dihydroxypropyl)-1-propylpyrrole-2-carboxamide (PubChem CID 66175814) has the molecular formula C11H17BrN2O3 and a molecular weight of 305.17 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydroxypropyl)-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2,3-dihydroxypropyl)-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66175814 |
| Molecular Formula | C11H17BrN2O3 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-bromo-N-(2,3-dihydroxypropyl)-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)NCC(O)CO |
| InChI | InChI=1S/C11H17BrN2O3/c1-2-3-14-6-8(12)4-10(14)11(17)13-5-9(16)7-15/h4,6,9,15-16H,2-3,5,7H2,1H3,(H,13,17) |
| InChIKey | PEZRFGGJCUFCLX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |