C12H17BrN2O4 — CID 114144339
3-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methoxypropanoic acid (PubChem CID 114144339) has the molecular formula C12H17BrN2O4 and a molecular weight of 333.18 g/mol. Its IUPAC name is 3-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methoxypropanoic acid.
| Compound Name | 3-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 114144339 |
| Molecular Formula | C12H17BrN2O4 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methoxypropanoic acid |
| SMILES | CCCn1cc(Br)cc1C(=O)NCC(OC)C(=O)O |
| InChI | InChI=1S/C12H17BrN2O4/c1-3-4-15-7-8(13)5-9(15)11(16)14-6-10(19-2)12(17)18/h5,7,10H,3-4,6H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | UPJJLJNFMMRWDY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |