C13H19BrN2O3 — CID 79792804
2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methylbutanoic acid (PubChem CID 79792804) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methylbutanoic acid.
| Compound Name | 2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79792804 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-methylbutanoic acid |
| SMILES | CCCn1cc(Br)cc1C(=O)NC(C)(CC)C(=O)O |
| InChI | InChI=1S/C13H19BrN2O3/c1-4-6-16-8-9(14)7-10(16)11(17)15-13(3,5-2)12(18)19/h7-8H,4-6H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | MUSNFDXZHOZWOD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |