C12H16BrN3O4 — CID 107821533
(2R)-4-amino-2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 107821533) has the molecular formula C12H16BrN3O4 and a molecular weight of 346.18 g/mol. Its IUPAC name is (2R)-4-amino-2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107821533 |
| Molecular Formula | C12H16BrN3O4 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (2R)-4-amino-2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | CCCn1cc(Br)cc1C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H16BrN3O4/c1-2-3-16-6-7(13)4-9(16)11(18)15-8(12(19)20)5-10(14)17/h4,6,8H,2-3,5H2,1H3,(H2,14,17)(H,15,18)(H,19,20)/t8-/m1/s1 |
| InChIKey | XTKZCRCHPCSXOX-MRVPVSSYSA-N |
| XLogP | 0.72 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |