C14H24BrN3O — CID 61249801
4-bromo-N-[2-(dimethylamino)-3-methylbutyl]-1-ethylpyrrole-2-carboxamide (PubChem CID 61249801) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is 4-bromo-N-[2-(dimethylamino)-3-methylbutyl]-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(dimethylamino)-3-methylbutyl]-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61249801 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-bromo-N-[2-(dimethylamino)-3-methylbutyl]-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCC(C(C)C)N(C)C |
| InChI | InChI=1S/C14H24BrN3O/c1-6-18-9-11(15)7-12(18)14(19)16-8-13(10(2)3)17(4)5/h7,9-10,13H,6,8H2,1-5H3,(H,16,19) |
| InChIKey | HHOVUAOOXUBIQN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |