C13H21BrN2O — CID 103461921
4-bromo-N-(2,2-dimethylbutyl)-1-ethylpyrrole-2-carboxamide (PubChem CID 103461921) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-bromo-N-(2,2-dimethylbutyl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2,2-dimethylbutyl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103461921 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-bromo-N-(2,2-dimethylbutyl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCC(C)(C)CC |
| InChI | InChI=1S/C13H21BrN2O/c1-5-13(3,4)9-15-12(17)11-7-10(14)8-16(11)6-2/h7-8H,5-6,9H2,1-4H3,(H,15,17) |
| InChIKey | NPWHLIJQGDBMOL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |