C12H18BrN3O2 — CID 113347877
N-(5-amino-5-oxopentyl)-4-bromo-1-ethylpyrrole-2-carboxamide (PubChem CID 113347877) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is N-(5-amino-5-oxopentyl)-4-bromo-1-ethylpyrrole-2-carboxamide.
| Compound Name | N-(5-amino-5-oxopentyl)-4-bromo-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 113347877 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-(5-amino-5-oxopentyl)-4-bromo-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCCCCC(N)=O |
| InChI | InChI=1S/C12H18BrN3O2/c1-2-16-8-9(13)7-10(16)12(18)15-6-4-3-5-11(14)17/h7-8H,2-6H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | HIPKFUVVCUBPAB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|