C12H17BrN2O2 — CID 66005799
4-bromo-1-ethyl-N-[(3-hydroxycyclobutyl)methyl]pyrrole-2-carboxamide (PubChem CID 66005799) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[(3-hydroxycyclobutyl)methyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[(3-hydroxycyclobutyl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66005799 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 4-bromo-1-ethyl-N-[(3-hydroxycyclobutyl)methyl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCC1CC(O)C1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-2-15-7-9(13)5-11(15)12(17)14-6-8-3-10(16)4-8/h5,7-8,10,16H,2-4,6H2,1H3,(H,14,17) |
| InChIKey | SKJFVQNKGVMKOD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |