C11H19BrClN3O — CID 120508068
N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-propan-2-ylpyrrole-2-carboxamide;hydrochloride (PubChem CID 120508068) has the molecular formula C11H19BrClN3O and a molecular weight of 324.65 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-propan-2-ylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-propan-2-ylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120508068 |
| Molecular Formula | C11H19BrClN3O |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-4-bromo-1-propan-2-ylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CC(C)n1cc(Br)cc1C(=O)N[C@@H](C)CN.Cl |
| InChI | InChI=1S/C11H18BrN3O.ClH/c1-7(2)15-6-9(12)4-10(15)11(16)14-8(3)5-13;/h4,6-8H,5,13H2,1-3H3,(H,14,16);1H/t8-;/m0./s1 |
| InChIKey | GLXSSBUKKYBEBF-QRPNPIFTSA-N |
| XLogP | 2.33 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |