C16H18Br2N2O — CID 63529150
4-bromo-N-[1-(4-bromophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 63529150) has the molecular formula C16H18Br2N2O and a molecular weight of 414.14 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-bromophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-(4-bromophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63529150 |
| Molecular Formula | C16H18Br2N2O |
| Molecular Weight | 414.14 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 4-bromo-N-[1-(4-bromophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)cn1C(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18Br2N2O/c1-10(2)20-9-14(18)8-15(20)16(21)19-11(3)12-4-6-13(17)7-5-12/h4-11H,1-3H3,(H,19,21) |
| InChIKey | WALUESUZCOPNGN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.14 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |