C14H14BrClN2O — CID 60698295
4-bromo-N-[1-(4-chlorophenyl)ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 60698295) has the molecular formula C14H14BrClN2O and a molecular weight of 341.64 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-chlorophenyl)ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-(4-chlorophenyl)ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60698295 |
| Molecular Formula | C14H14BrClN2O |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 4-bromo-N-[1-(4-chlorophenyl)ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)cn1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14BrClN2O/c1-9(10-3-5-12(16)6-4-10)17-14(19)13-7-11(15)8-18(13)2/h3-9H,1-2H3,(H,17,19) |
| InChIKey | LKNZLFZJQXKFOH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |