C15H17BrN4O2 — CID 87011236
4-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 87011236) has the molecular formula C15H17BrN4O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is 4-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 87011236 |
| Molecular Formula | C15H17BrN4O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 4-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)cn1C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H17BrN4O2/c1-9(10-3-5-12(6-4-10)19-15(17)22)18-14(21)13-7-11(16)8-20(13)2/h3-9H,1-2H3,(H,18,21)(H3,17,19,22) |
| InChIKey | HEBQYXTZWBCEBF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |