C14H14BrN3O3 — CID 106852997
2-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]furan-3-carboxamide (PubChem CID 106852997) has the molecular formula C14H14BrN3O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is 2-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106852997 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2-bromo-N-[1-[4-(carbamoylamino)phenyl]ethyl]furan-3-carboxamide |
| SMILES | CC(NC(=O)c1ccoc1Br)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C14H14BrN3O3/c1-8(17-13(19)11-6-7-21-12(11)15)9-2-4-10(5-3-9)18-14(16)20/h2-8H,1H3,(H,17,19)(H3,16,18,20) |
| InChIKey | IBRBNPIAWXARNQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |