C16H16FN3O2 — CID 94062816
N-[(1R)-1-[4-(carbamoylamino)phenyl]ethyl]-2-fluorobenzamide (PubChem CID 94062816) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[(1R)-1-[4-(carbamoylamino)phenyl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[(1R)-1-[4-(carbamoylamino)phenyl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 94062816 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[(1R)-1-[4-(carbamoylamino)phenyl]ethyl]-2-fluorobenzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1F)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C16H16FN3O2/c1-10(11-6-8-12(9-7-11)20-16(18)22)19-15(21)13-4-2-3-5-14(13)17/h2-10H,1H3,(H,19,21)(H3,18,20,22)/t10-/m1/s1 |
| InChIKey | ACSFJZBZWHZFGQ-SNVBAGLBSA-N |
| XLogP | 2.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |