C18H21N3O4 — CID 47034214
N-[1-[4-(carbamoylamino)phenyl]ethyl]-2,3-dimethoxybenzamide (PubChem CID 47034214) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[1-[4-(carbamoylamino)phenyl]ethyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 47034214 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(C)c2ccc(NC(N)=O)cc2)c1OC |
| InChI | InChI=1S/C18H21N3O4/c1-11(12-7-9-13(10-8-12)21-18(19)23)20-17(22)14-5-4-6-15(24-2)16(14)25-3/h4-11H,1-3H3,(H,20,22)(H3,19,21,23) |
| InChIKey | ORIGTNNUULTMQJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |