C24H23F2N3O4 — CID 55962117
2-(difluoromethoxy)-3-methoxy-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]benzamide (PubChem CID 55962117) has the molecular formula C24H23F2N3O4 and a molecular weight of 455.46 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3-methoxy-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-3-methoxy-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 55962117 |
| Molecular Formula | C24H23F2N3O4 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-(difluoromethoxy)-3-methoxy-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NC(C)c2ccc(NC(=O)Nc3ccccc3)cc2)c1OC(F)F |
| InChI | InChI=1S/C24H23F2N3O4/c1-15(27-22(30)19-9-6-10-20(32-2)21(19)33-23(25)26)16-11-13-18(14-12-16)29-24(31)28-17-7-4-3-5-8-17/h3-15,23H,1-2H3,(H,27,30)(H2,28,29,31) |
| InChIKey | ZWZFKCZZFZGYLW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |