C19H20N4O3 — CID 45352345
2,3-dimethoxy-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 45352345) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 45352345 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2,3-dimethoxy-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NC(C)c2ccc(-n3cncn3)cc2)c1OC |
| InChI | InChI=1S/C19H20N4O3/c1-13(14-7-9-15(10-8-14)23-12-20-11-21-23)22-19(24)16-5-4-6-17(25-2)18(16)26-3/h4-13H,1-3H3,(H,22,24) |
| InChIKey | HGGYWPZHPOEHQV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |