C16H13F4NO — CID 42955470
2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 42955470) has the molecular formula C16H13F4NO and a molecular weight of 311.28 g/mol. Its IUPAC name is 2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 42955470 |
| Molecular Formula | C16H13F4NO |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-fluoro-N-[1-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F4NO/c1-10(11-6-8-12(9-7-11)16(18,19)20)21-15(22)13-4-2-3-5-14(13)17/h2-10H,1H3,(H,21,22) |
| InChIKey | HUUBIDVAQQLIFS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |