C16H12Cl2F3NO — CID 37354874
2,3-dichloro-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 37354874) has the molecular formula C16H12Cl2F3NO and a molecular weight of 362.18 g/mol. Its IUPAC name is 2,3-dichloro-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 37354874 |
| Molecular Formula | C16H12Cl2F3NO |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2,3-dichloro-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(Cl)c1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12Cl2F3NO/c1-9(10-5-7-11(8-6-10)16(19,20)21)22-15(23)12-3-2-4-13(17)14(12)18/h2-9H,1H3,(H,22,23)/t9-/m1/s1 |
| InChIKey | OWFXWHYPFVVEMV-SECBINFHSA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |