C16H12Cl2F3NO — CID 26594295
2,3-dichloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 26594295) has the molecular formula C16H12Cl2F3NO and a molecular weight of 362.18 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2,3-dichloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 26594295 |
| Molecular Formula | C16H12Cl2F3NO |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2,3-dichloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl2F3NO/c17-13-3-1-2-12(14(13)18)15(23)22-9-8-10-4-6-11(7-5-10)16(19,20)21/h1-7H,8-9H2,(H,22,23) |
| InChIKey | OIVIYRXGNGYWKX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |