C17H15ClF3NO — CID 26594302
2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 26594302) has the molecular formula C17H15ClF3NO and a molecular weight of 341.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 26594302 |
| Molecular Formula | C17H15ClF3NO |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15ClF3NO/c18-15-7-3-13(4-8-15)11-16(23)22-10-9-12-1-5-14(6-2-12)17(19,20)21/h1-8H,9-11H2,(H,22,23) |
| InChIKey | MELWXMQJXOKHLF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |