C14H16ClN3O3S — CID 31136747
4-chloro-1-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide (PubChem CID 31136747) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide.
| Compound Name | 4-chloro-1-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 31136747 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-chloro-1-methyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]pyrrole-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc(Cl)cn1C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H16ClN3O3S/c1-9(10-3-5-12(6-4-10)22(16,20)21)17-14(19)13-7-11(15)8-18(13)2/h3-9H,1-2H3,(H,17,19)(H2,16,20,21)/t9-/m0/s1 |
| InChIKey | HMLDXRJTCPKYNW-VIFPVBQESA-N |
| XLogP | 1.82 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |