C11H11ClN4O3S2 — CID 80618162
5-chloro-N-[1-(4-sulfamoylphenyl)ethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80618162) has the molecular formula C11H11ClN4O3S2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 5-chloro-N-[1-(4-sulfamoylphenyl)ethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-[1-(4-sulfamoylphenyl)ethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80618162 |
| Molecular Formula | C11H11ClN4O3S2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 5-chloro-N-[1-(4-sulfamoylphenyl)ethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(NC(=O)c1nnc(Cl)s1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H11ClN4O3S2/c1-6(14-9(17)10-15-16-11(12)20-10)7-2-4-8(5-3-7)21(13,18)19/h2-6H,1H3,(H,14,17)(H2,13,18,19) |
| InChIKey | NVEYYBKDNNCSBO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |