C13H15N3O4S — CID 79489950
4-methyl-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-5-carboxamide (PubChem CID 79489950) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-methyl-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 79489950 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-methyl-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)NC(C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H15N3O4S/c1-8(16-13(17)12-9(2)15-7-20-12)10-3-5-11(6-4-10)21(14,18)19/h3-8H,1-2H3,(H,16,17)(H2,14,18,19) |
| InChIKey | HELSMZSHPSCZIM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |