C16H17ClN2O3S — CID 26012630
N-[(1S)-1-(4-chlorophenyl)ethyl]-2-methyl-5-sulfamoylbenzamide (PubChem CID 26012630) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is N-[(1S)-1-(4-chlorophenyl)ethyl]-2-methyl-5-sulfamoylbenzamide.
| Compound Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 26012630 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)N[C@@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-10-3-8-14(23(18,21)22)9-15(10)16(20)19-11(2)12-4-6-13(17)7-5-12/h3-9,11H,1-2H3,(H,19,20)(H2,18,21,22)/t11-/m0/s1 |
| InChIKey | LCUXIWFHOOCVTG-NSHDSACASA-N |
| XLogP | 2.79 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |