C15H15Cl2N3O3S — CID 75811590
1-(2,4-dichlorophenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 75811590) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 75811590 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(Cl)cc1Cl)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-9(10-2-5-12(6-3-10)24(18,22)23)19-15(21)20-14-7-4-11(16)8-13(14)17/h2-9H,1H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | SRYBSFAAISYPCK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |