C22H23N5O4S — CID 52504623
1-phenyl-3-[4-[(1R)-1-[(4-sulfamoylphenyl)carbamoylamino]ethyl]phenyl]urea (PubChem CID 52504623) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 1-phenyl-3-[4-[(1R)-1-[(4-sulfamoylphenyl)carbamoylamino]ethyl]phenyl]urea.
| Compound Name | 1-phenyl-3-[4-[(1R)-1-[(4-sulfamoylphenyl)carbamoylamino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 52504623 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 1-phenyl-3-[4-[(1R)-1-[(4-sulfamoylphenyl)carbamoylamino]ethyl]phenyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1ccc(S(N)(=O)=O)cc1)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N5O4S/c1-15(24-21(28)26-19-11-13-20(14-12-19)32(23,30)31)16-7-9-18(10-8-16)27-22(29)25-17-5-3-2-4-6-17/h2-15H,1H3,(H2,23,30,31)(H2,24,26,28)(H2,25,27,29)/t15-/m1/s1 |
| InChIKey | VJKJSCGQLCGSOR-OAHLLOKOSA-N |
| XLogP | 3.86 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |