C16H16F3N3O4S — CID 51944392
1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 51944392) has the molecular formula C16H16F3N3O4S and a molecular weight of 403.38 g/mol. Its IUPAC name is 1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 51944392 |
| Molecular Formula | C16H16F3N3O4S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(OC(F)(F)F)cc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16F3N3O4S/c1-10(11-2-8-14(9-3-11)27(20,24)25)21-15(23)22-12-4-6-13(7-5-12)26-16(17,18)19/h2-10H,1H3,(H2,20,24,25)(H2,21,22,23)/t10-/m0/s1 |
| InChIKey | FYCRQTMTBOPVAW-JTQLQIEISA-N |
| XLogP | 3.12 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |