C11H13F3N2O4S — CID 94033199
2,2,2-trifluoroethyl N-[(1S)-1-(4-sulfamoylphenyl)ethyl]carbamate (PubChem CID 94033199) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(1S)-1-(4-sulfamoylphenyl)ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[(1S)-1-(4-sulfamoylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 94033199 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(1S)-1-(4-sulfamoylphenyl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OCC(F)(F)F)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H13F3N2O4S/c1-7(16-10(17)20-6-11(12,13)14)8-2-4-9(5-3-8)21(15,18)19/h2-5,7H,6H2,1H3,(H,16,17)(H2,15,18,19)/t7-/m0/s1 |
| InChIKey | YWECKJAVWIVBKG-ZETCQYMHSA-N |
| XLogP | 1.68 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |