C11H11BrF3NO2 — CID 65168603
2,2,2-trifluoroethyl N-[1-(3-bromophenyl)ethyl]carbamate (PubChem CID 65168603) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[1-(3-bromophenyl)ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[1-(3-bromophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 65168603 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[1-(3-bromophenyl)ethyl]carbamate |
| SMILES | CC(NC(=O)OCC(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H11BrF3NO2/c1-7(8-3-2-4-9(12)5-8)16-10(17)18-6-11(13,14)15/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | UQINNDRAQMTXRZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |