C12H14F3NO3 — CID 81373961
2,2,2-trifluoroethyl N-[(1R)-1-(3-methoxyphenyl)ethyl]carbamate (PubChem CID 81373961) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(1R)-1-(3-methoxyphenyl)ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[(1R)-1-(3-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 81373961 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(1R)-1-(3-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1cccc([C@@H](C)NC(=O)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3/c1-8(9-4-3-5-10(6-9)18-2)16-11(17)19-7-12(13,14)15/h3-6,8H,7H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | CFQDLOPQEUFIHQ-MRVPVSSYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |