C23H26N4O3S — CID 60543342
1-[4-[benzyl(methyl)amino]phenyl]-3-[1-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 60543342) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[4-[benzyl(methyl)amino]phenyl]-3-[1-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[4-[benzyl(methyl)amino]phenyl]-3-[1-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 60543342 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[4-[benzyl(methyl)amino]phenyl]-3-[1-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(N(C)Cc2ccccc2)cc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-17(19-8-14-22(15-9-19)31(24,29)30)25-23(28)26-20-10-12-21(13-11-20)27(2)16-18-6-4-3-5-7-18/h3-15,17H,16H2,1-2H3,(H2,24,29,30)(H2,25,26,28) |
| InChIKey | FSCQGCYJGMWVQT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|