C19H25N3O3S — CID 32727461
(2R)-2-[benzyl(methyl)amino]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 32727461) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is (2R)-2-[benzyl(methyl)amino]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-[benzyl(methyl)amino]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 32727461 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (2R)-2-[benzyl(methyl)amino]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | C[C@H](NC(=O)[C@@H](C)N(C)Cc1ccccc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-14(17-9-11-18(12-10-17)26(20,24)25)21-19(23)15(2)22(3)13-16-7-5-4-6-8-16/h4-12,14-15H,13H2,1-3H3,(H,21,23)(H2,20,24,25)/t14-,15+/m0/s1 |
| InChIKey | NCRSODFNIOAJMC-LSDHHAIUSA-N |
| XLogP | 2.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |