C16H18ClN3O3S — CID 24612359
1-(3-chloro-4-methylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 24612359) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 24612359 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | Cc1ccc(NC(=O)NC(C)c2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O3S/c1-10-3-6-13(9-15(10)17)20-16(21)19-11(2)12-4-7-14(8-5-12)24(18,22)23/h3-9,11H,1-2H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | CRPYUJCDOGGXOA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |